C19H17N3O5 — CID 15995995
2-(4-methylphenyl)-5-morpholin-4-yl-6-nitroisoindole-1,3-dione (PubChem CID 15995995) has the molecular formula C19H17N3O5 and a molecular weight of 367.36 g/mol. Its IUPAC name is 2-(4-methylphenyl)-5-morpholin-4-yl-6-nitroisoindole-1,3-dione.
| Compound Name | 2-(4-methylphenyl)-5-morpholin-4-yl-6-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 15995995 |
| Molecular Formula | C19H17N3O5 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 2-(4-methylphenyl)-5-morpholin-4-yl-6-nitroisoindole-1,3-dione |
| SMILES | Cc1ccc(N2C(=O)c3cc(N4CCOCC4)c([N+](=O)[O-])cc3C2=O)cc1 |
| InChI | InChI=1S/C19H17N3O5/c1-12-2-4-13(5-3-12)21-18(23)14-10-16(20-6-8-27-9-7-20)17(22(25)26)11-15(14)19(21)24/h2-5,10-11H,6-9H2,1H3 |
| InChIKey | XLYLBKLHESPKJL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|