C25H21ClN4O4 — CID 15993434
5-[4-(2-chlorophenyl)piperazin-1-yl]-2-(4-methylphenyl)-6-nitroisoindole-1,3-dione (PubChem CID 15993434) has the molecular formula C25H21ClN4O4 and a molecular weight of 476.92 g/mol. Its IUPAC name is 5-[4-(2-chlorophenyl)piperazin-1-yl]-2-(4-methylphenyl)-6-nitroisoindole-1,3-dione.
| Compound Name | 5-[4-(2-chlorophenyl)piperazin-1-yl]-2-(4-methylphenyl)-6-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 15993434 |
| Molecular Formula | C25H21ClN4O4 |
| Molecular Weight | 476.92 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 5-[4-(2-chlorophenyl)piperazin-1-yl]-2-(4-methylphenyl)-6-nitroisoindole-1,3-dione |
| SMILES | Cc1ccc(N2C(=O)c3cc(N4CCN(c5ccccc5Cl)CC4)c([N+](=O)[O-])cc3C2=O)cc1 |
| InChI | InChI=1S/C25H21ClN4O4/c1-16-6-8-17(9-7-16)29-24(31)18-14-22(23(30(33)34)15-19(18)25(29)32)28-12-10-27(11-13-28)21-5-3-2-4-20(21)26/h2-9,14-15H,10-13H2,1H3 |
| InChIKey | XFYCTCDIXXVZOO-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 87.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.92 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|