C25H24N4O4 — CID 3094159
1,3-dibenzyl-5-morpholin-4-yl-6-nitrobenzimidazol-2-one (PubChem CID 3094159) has the molecular formula C25H24N4O4 and a molecular weight of 444.49 g/mol. Its IUPAC name is 1,3-dibenzyl-5-morpholin-4-yl-6-nitrobenzimidazol-2-one.
| Compound Name | 1,3-dibenzyl-5-morpholin-4-yl-6-nitrobenzimidazol-2-one |
|---|---|
| PubChem CID | 3094159 |
| Molecular Formula | C25H24N4O4 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 1,3-dibenzyl-5-morpholin-4-yl-6-nitrobenzimidazol-2-one |
| SMILES | O=c1n(Cc2ccccc2)c2cc(N3CCOCC3)c([N+](=O)[O-])cc2n1Cc1ccccc1 |
| InChI | InChI=1S/C25H24N4O4/c30-25-27(17-19-7-3-1-4-8-19)22-15-21(26-11-13-33-14-12-26)24(29(31)32)16-23(22)28(25)18-20-9-5-2-6-10-20/h1-10,15-16H,11-14,17-18H2 |
| InChIKey | YKMMKMMYJFUVBW-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 82.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|