About 7-methoxy-1,3,6-trimethylpteridine-2,4-dione
7-methoxy-1,3,6-trimethylpteridine-2,4-dione (PubChem CID 69440037) has the molecular formula C10H12N4O3
and a molecular weight of 236.23 g/mol. Its IUPAC name is 7-methoxy-1,3,6-trimethylpteridine-2,4-dione.
Molecular Properties
| Compound Name | 7-methoxy-1,3,6-trimethylpteridine-2,4-dione |
| PubChem CID | 69440037 |
| Molecular Formula | C10H12N4O3 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 7-methoxy-1,3,6-trimethylpteridine-2,4-dione |
| SMILES | COc1nc2c(nc1C)c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C10H12N4O3/c1-5-8(17-4)12-7-6(11-5)9(15)14(3)10(16)13(7)2/h1-4H3 |
| InChIKey | FVPCBACYWIXFQY-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 79.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 7-methoxy-1,3,6-trimethylpteridine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-1,3,6-trimethylpteridine-2,4-dione?
The IUPAC name of 7-methoxy-1,3,6-trimethylpteridine-2,4-dione (CID 69440037) is 7-methoxy-1,3,6-trimethylpteridine-2,4-dione.
What is the SMILES notation for 7-methoxy-1,3,6-trimethylpteridine-2,4-dione?
The canonical SMILES for 7-methoxy-1,3,6-trimethylpteridine-2,4-dione is COc1nc2c(nc1C)c(=O)n(C)c(=O)n2C.
What is the InChIKey of 7-methoxy-1,3,6-trimethylpteridine-2,4-dione?
The InChIKey is FVPCBACYWIXFQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4O3/c1-5-8(17-4)12-7-6(11-5)9(15)14(3)10(16)13(7)2/h1-4H3.
What are the key properties of 7-methoxy-1,3,6-trimethylpteridine-2,4-dione?
7-methoxy-1,3,6-trimethylpteridine-2,4-dione has a molecular weight of 236.23 g/mol, XLogP of -0.66, 1 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-1,3,6-trimethylpteridine-2,4-dione is sourced from PubChem (CID 69440037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).