C14H11BrN4O3 — CID 135442652
7-bromo-6-(4-hydroxyphenyl)-1,3-dimethylpteridine-2,4-dione (PubChem CID 135442652) has the molecular formula C14H11BrN4O3 and a molecular weight of 363.17 g/mol. Its IUPAC name is 7-bromo-6-(4-hydroxyphenyl)-1,3-dimethylpteridine-2,4-dione.
| Compound Name | 7-bromo-6-(4-hydroxyphenyl)-1,3-dimethylpteridine-2,4-dione |
|---|---|
| PubChem CID | 135442652 |
| Molecular Formula | C14H11BrN4O3 |
| Molecular Weight | 363.17 g/mol |
| Exact Mass | 362.00 |
| IUPAC Name | 7-bromo-6-(4-hydroxyphenyl)-1,3-dimethylpteridine-2,4-dione |
| SMILES | Cn1c(=O)c2nc(-c3ccc(O)cc3)c(Br)nc2n(C)c1=O |
| InChI | InChI=1S/C14H11BrN4O3/c1-18-12-10(13(21)19(2)14(18)22)16-9(11(15)17-12)7-3-5-8(20)6-4-7/h3-6,20H,1-2H3 |
| InChIKey | AECUDBPVDYVGHR-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.17 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |