C20H15ClN4O2 — CID 11463083
1-benzyl-7-chloro-3-methyl-6-phenylpteridine-2,4-dione (PubChem CID 11463083) has the molecular formula C20H15ClN4O2 and a molecular weight of 378.82 g/mol. Its IUPAC name is 1-benzyl-7-chloro-3-methyl-6-phenylpteridine-2,4-dione.
| Compound Name | 1-benzyl-7-chloro-3-methyl-6-phenylpteridine-2,4-dione |
|---|---|
| PubChem CID | 11463083 |
| Molecular Formula | C20H15ClN4O2 |
| Molecular Weight | 378.82 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 1-benzyl-7-chloro-3-methyl-6-phenylpteridine-2,4-dione |
| SMILES | Cn1c(=O)c2nc(-c3ccccc3)c(Cl)nc2n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C20H15ClN4O2/c1-24-19(26)16-18(25(20(24)27)12-13-8-4-2-5-9-13)23-17(21)15(22-16)14-10-6-3-7-11-14/h2-11H,12H2,1H3 |
| InChIKey | XQQBYWCCCUUWTK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.82 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |