C17H17N3O2 — CID 102354391
8-benzyl-3,5,7-trimethylpyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 102354391) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is 8-benzyl-3,5,7-trimethylpyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 8-benzyl-3,5,7-trimethylpyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 102354391 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 8-benzyl-3,5,7-trimethylpyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | Cc1cc(C)n(Cc2ccccc2)c2nc(=O)n(C)c(=O)c1-2 |
| InChI | InChI=1S/C17H17N3O2/c1-11-9-12(2)20(10-13-7-5-4-6-8-13)15-14(11)16(21)19(3)17(22)18-15/h4-9H,10H2,1-3H3 |
| InChIKey | GRKUVLKYRZINFQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |