About 2,4-dimethyl-3,5-dioxo-1,2,4-triazine-6-carbonitrile
2,4-dimethyl-3,5-dioxo-1,2,4-triazine-6-carbonitrile (PubChem CID 20616015) has the molecular formula C6H6N4O2
and a molecular weight of 166.14 g/mol. Its IUPAC name is 2,4-dimethyl-3,5-dioxo-1,2,4-triazine-6-carbonitrile.
Analyze 2,4-dimethyl-3,5-dioxo-1,2,4-triazine-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-3,5-dioxo-1,2,4-triazine-6-carbonitrile?
The IUPAC name of 2,4-dimethyl-3,5-dioxo-1,2,4-triazine-6-carbonitrile (CID 20616015) is 2,4-dimethyl-3,5-dioxo-1,2,4-triazine-6-carbonitrile.
What is the SMILES notation for 2,4-dimethyl-3,5-dioxo-1,2,4-triazine-6-carbonitrile?
The canonical SMILES for 2,4-dimethyl-3,5-dioxo-1,2,4-triazine-6-carbonitrile is Cn1nc(C#N)c(=O)n(C)c1=O.
What is the InChIKey of 2,4-dimethyl-3,5-dioxo-1,2,4-triazine-6-carbonitrile?
The InChIKey is VTSDVELFQHRQIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4O2/c1-9-5(11)4(3-7)8-10(2)6(9)12/h1-2H3.
What are the key properties of 2,4-dimethyl-3,5-dioxo-1,2,4-triazine-6-carbonitrile?
2,4-dimethyl-3,5-dioxo-1,2,4-triazine-6-carbonitrile has a molecular weight of 166.14 g/mol, XLogP of -1.65, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-3,5-dioxo-1,2,4-triazine-6-carbonitrile is sourced from PubChem (CID 20616015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).