C13H17N7O2 — CID 100710657
1,3-dimethyl-4-[2-[(1-methylpyrazol-3-yl)amino]ethylamino]-2,6-dioxopyrimidine-5-carbonitrile (PubChem CID 100710657) has the molecular formula C13H17N7O2 and a molecular weight of 303.33 g/mol. Its IUPAC name is 1,3-dimethyl-4-[2-[(1-methylpyrazol-3-yl)amino]ethylamino]-2,6-dioxopyrimidine-5-carbonitrile.
| Compound Name | 1,3-dimethyl-4-[2-[(1-methylpyrazol-3-yl)amino]ethylamino]-2,6-dioxopyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 100710657 |
| Molecular Formula | C13H17N7O2 |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 1,3-dimethyl-4-[2-[(1-methylpyrazol-3-yl)amino]ethylamino]-2,6-dioxopyrimidine-5-carbonitrile |
| SMILES | Cn1ccc(NCCNc2c(C#N)c(=O)n(C)c(=O)n2C)n1 |
| InChI | InChI=1S/C13H17N7O2/c1-18-7-4-10(17-18)15-5-6-16-11-9(8-14)12(21)20(3)13(22)19(11)2/h4,7,16H,5-6H2,1-3H3,(H,15,17) |
| InChIKey | BUFARBTUTUVSKY-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|