C10H20N4 — CID 103568574
N'-(1-methylpyrazol-3-yl)hexane-1,6-diamine (PubChem CID 103568574) has the molecular formula C10H20N4 and a molecular weight of 196.30 g/mol. Its IUPAC name is N'-(1-methylpyrazol-3-yl)hexane-1,6-diamine.
| Compound Name | N'-(1-methylpyrazol-3-yl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 103568574 |
| Molecular Formula | C10H20N4 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | N'-(1-methylpyrazol-3-yl)hexane-1,6-diamine |
| SMILES | Cn1ccc(NCCCCCCN)n1 |
| InChI | InChI=1S/C10H20N4/c1-14-9-6-10(13-14)12-8-5-3-2-4-7-11/h6,9H,2-5,7-8,11H2,1H3,(H,12,13) |
| InChIKey | AOJRVSYNAPARIE-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|