C9H17N3O2 — CID 79778277
N-[2-(2-methoxyethoxy)ethyl]-1-methylpyrazol-3-amine (PubChem CID 79778277) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is N-[2-(2-methoxyethoxy)ethyl]-1-methylpyrazol-3-amine.
| Compound Name | N-[2-(2-methoxyethoxy)ethyl]-1-methylpyrazol-3-amine |
|---|---|
| PubChem CID | 79778277 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | N-[2-(2-methoxyethoxy)ethyl]-1-methylpyrazol-3-amine |
| SMILES | COCCOCCNc1ccn(C)n1 |
| InChI | InChI=1S/C9H17N3O2/c1-12-5-3-9(11-12)10-4-6-14-8-7-13-2/h3,5H,4,6-8H2,1-2H3,(H,10,11) |
| InChIKey | YYXWZKULYBVGTE-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|