C6H11N3O — CID 23443606
2-[(1-methylpyrazol-3-yl)amino]ethanol (PubChem CID 23443606) has the molecular formula C6H11N3O and a molecular weight of 141.17 g/mol. Its IUPAC name is 2-[(1-methylpyrazol-3-yl)amino]ethanol.
| Compound Name | 2-[(1-methylpyrazol-3-yl)amino]ethanol |
|---|---|
| PubChem CID | 23443606 |
| Molecular Formula | C6H11N3O |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.09 |
| IUPAC Name | 2-[(1-methylpyrazol-3-yl)amino]ethanol |
| SMILES | Cn1ccc(NCCO)n1 |
| InChI | InChI=1S/C6H11N3O/c1-9-4-2-6(8-9)7-3-5-10/h2,4,10H,3,5H2,1H3,(H,7,8) |
| InChIKey | MKUPKEBJQLIRMK-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |