C7H13N3O — CID 106932300
(2R)-1-[(1-methylpyrazol-3-yl)amino]propan-2-ol (PubChem CID 106932300) has the molecular formula C7H13N3O and a molecular weight of 155.20 g/mol. Its IUPAC name is (2R)-1-[(1-methylpyrazol-3-yl)amino]propan-2-ol.
| Compound Name | (2R)-1-[(1-methylpyrazol-3-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 106932300 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | (2R)-1-[(1-methylpyrazol-3-yl)amino]propan-2-ol |
| SMILES | C[C@@H](O)CNc1ccn(C)n1 |
| InChI | InChI=1S/C7H13N3O/c1-6(11)5-8-7-3-4-10(2)9-7/h3-4,6,11H,5H2,1-2H3,(H,8,9)/t6-/m1/s1 |
| InChIKey | GOCWHZXWEOEMJF-ZCFIWIBFSA-N |
| XLogP | 0.21 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |