C14H19N3O2 — CID 79779688
1-(4-methylphenoxy)-3-[(1-methylpyrazol-3-yl)amino]propan-2-ol (PubChem CID 79779688) has the molecular formula C14H19N3O2 and a molecular weight of 261.33 g/mol. Its IUPAC name is 1-(4-methylphenoxy)-3-[(1-methylpyrazol-3-yl)amino]propan-2-ol.
| Compound Name | 1-(4-methylphenoxy)-3-[(1-methylpyrazol-3-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 79779688 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 1-(4-methylphenoxy)-3-[(1-methylpyrazol-3-yl)amino]propan-2-ol |
| SMILES | Cc1ccc(OCC(O)CNc2ccn(C)n2)cc1 |
| InChI | InChI=1S/C14H19N3O2/c1-11-3-5-13(6-4-11)19-10-12(18)9-15-14-7-8-17(2)16-14/h3-8,12,18H,9-10H2,1-2H3,(H,15,16) |
| InChIKey | GFMLLRNVQDGSKV-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |