C14H18FN3O2 — CID 79778483
1-[(2-fluorophenyl)methoxy]-3-[(1-methylpyrazol-3-yl)amino]propan-2-ol (PubChem CID 79778483) has the molecular formula C14H18FN3O2 and a molecular weight of 279.31 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methoxy]-3-[(1-methylpyrazol-3-yl)amino]propan-2-ol.
| Compound Name | 1-[(2-fluorophenyl)methoxy]-3-[(1-methylpyrazol-3-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 79778483 |
| Molecular Formula | C14H18FN3O2 |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 1-[(2-fluorophenyl)methoxy]-3-[(1-methylpyrazol-3-yl)amino]propan-2-ol |
| SMILES | Cn1ccc(NCC(O)COCc2ccccc2F)n1 |
| InChI | InChI=1S/C14H18FN3O2/c1-18-7-6-14(17-18)16-8-12(19)10-20-9-11-4-2-3-5-13(11)15/h2-7,12,19H,8-10H2,1H3,(H,16,17) |
| InChIKey | OGFUNFGKMPFWAE-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |