C16H26FNO2 — CID 103829136
1-[(2-fluorophenyl)methoxy]-3-(3-methylpentan-3-ylamino)propan-2-ol (PubChem CID 103829136) has the molecular formula C16H26FNO2 and a molecular weight of 283.39 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methoxy]-3-(3-methylpentan-3-ylamino)propan-2-ol.
| Compound Name | 1-[(2-fluorophenyl)methoxy]-3-(3-methylpentan-3-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 103829136 |
| Molecular Formula | C16H26FNO2 |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 1-[(2-fluorophenyl)methoxy]-3-(3-methylpentan-3-ylamino)propan-2-ol |
| SMILES | CCC(C)(CC)NCC(O)COCc1ccccc1F |
| InChI | InChI=1S/C16H26FNO2/c1-4-16(3,5-2)18-10-14(19)12-20-11-13-8-6-7-9-15(13)17/h6-9,14,18-19H,4-5,10-12H2,1-3H3 |
| InChIKey | IHNUQDDGYYNHJN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |