C10H19N3O3 — CID 106990156
1-(2-methoxyethoxy)-3-[(1-methylpyrazol-3-yl)amino]propan-2-ol (PubChem CID 106990156) has the molecular formula C10H19N3O3 and a molecular weight of 229.28 g/mol. Its IUPAC name is 1-(2-methoxyethoxy)-3-[(1-methylpyrazol-3-yl)amino]propan-2-ol.
| Compound Name | 1-(2-methoxyethoxy)-3-[(1-methylpyrazol-3-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 106990156 |
| Molecular Formula | C10H19N3O3 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.14 |
| IUPAC Name | 1-(2-methoxyethoxy)-3-[(1-methylpyrazol-3-yl)amino]propan-2-ol |
| SMILES | COCCOCC(O)CNc1ccn(C)n1 |
| InChI | InChI=1S/C10H19N3O3/c1-13-4-3-10(12-13)11-7-9(14)8-16-6-5-15-2/h3-4,9,14H,5-8H2,1-2H3,(H,11,12) |
| InChIKey | FSBIUWBXPSNGGI-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|