C9H18N4 — CID 103568549
2-ethyl-N'-(1-methylpyrazol-3-yl)propane-1,3-diamine (PubChem CID 103568549) has the molecular formula C9H18N4 and a molecular weight of 182.27 g/mol. Its IUPAC name is 2-ethyl-N'-(1-methylpyrazol-3-yl)propane-1,3-diamine.
| Compound Name | 2-ethyl-N'-(1-methylpyrazol-3-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 103568549 |
| Molecular Formula | C9H18N4 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | 2-ethyl-N'-(1-methylpyrazol-3-yl)propane-1,3-diamine |
| SMILES | CCC(CN)CNc1ccn(C)n1 |
| InChI | InChI=1S/C9H18N4/c1-3-8(6-10)7-11-9-4-5-13(2)12-9/h4-5,8H,3,6-7,10H2,1-2H3,(H,11,12) |
| InChIKey | CTMYSXCLPKQGLG-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |