C13H17N3 — CID 75517812
1-methyl-N-[2-(4-methylphenyl)ethyl]pyrazol-3-amine (PubChem CID 75517812) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is 1-methyl-N-[2-(4-methylphenyl)ethyl]pyrazol-3-amine.
| Compound Name | 1-methyl-N-[2-(4-methylphenyl)ethyl]pyrazol-3-amine |
|---|---|
| PubChem CID | 75517812 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 1-methyl-N-[2-(4-methylphenyl)ethyl]pyrazol-3-amine |
| SMILES | Cc1ccc(CCNc2ccn(C)n2)cc1 |
| InChI | InChI=1S/C13H17N3/c1-11-3-5-12(6-4-11)7-9-14-13-8-10-16(2)15-13/h3-6,8,10H,7,9H2,1-2H3,(H,14,15) |
| InChIKey | JOSPLTTYVNWJOK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |