C11H12IN3 — CID 79778850
N-[(4-iodophenyl)methyl]-1-methylpyrazol-3-amine (PubChem CID 79778850) has the molecular formula C11H12IN3 and a molecular weight of 313.14 g/mol. Its IUPAC name is N-[(4-iodophenyl)methyl]-1-methylpyrazol-3-amine.
| Compound Name | N-[(4-iodophenyl)methyl]-1-methylpyrazol-3-amine |
|---|---|
| PubChem CID | 79778850 |
| Molecular Formula | C11H12IN3 |
| Molecular Weight | 313.14 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | N-[(4-iodophenyl)methyl]-1-methylpyrazol-3-amine |
| SMILES | Cn1ccc(NCc2ccc(I)cc2)n1 |
| InChI | InChI=1S/C11H12IN3/c1-15-7-6-11(14-15)13-8-9-2-4-10(12)5-3-9/h2-7H,8H2,1H3,(H,13,14) |
| InChIKey | CAIGGVLKWNTMOA-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.14 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|