C8H10N4O — CID 139295160
1-methyl-N-(1,2-oxazol-4-ylmethyl)pyrazol-3-amine (PubChem CID 139295160) has the molecular formula C8H10N4O and a molecular weight of 178.19 g/mol. Its IUPAC name is 1-methyl-N-(1,2-oxazol-4-ylmethyl)pyrazol-3-amine.
| Compound Name | 1-methyl-N-(1,2-oxazol-4-ylmethyl)pyrazol-3-amine |
|---|---|
| PubChem CID | 139295160 |
| Molecular Formula | C8H10N4O |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 1-methyl-N-(1,2-oxazol-4-ylmethyl)pyrazol-3-amine |
| SMILES | Cn1ccc(NCc2cnoc2)n1 |
| InChI | InChI=1S/C8H10N4O/c1-12-3-2-8(11-12)9-4-7-5-10-13-6-7/h2-3,5-6H,4H2,1H3,(H,9,11) |
| InChIKey | XGRSTHXSQRVXKC-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 55.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |