C9H10BrN3S — CID 60808995
N-[(5-bromothiophen-2-yl)methyl]-1-methylpyrazol-3-amine (PubChem CID 60808995) has the molecular formula C9H10BrN3S and a molecular weight of 272.17 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-1-methylpyrazol-3-amine.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-1-methylpyrazol-3-amine |
|---|---|
| PubChem CID | 60808995 |
| Molecular Formula | C9H10BrN3S |
| Molecular Weight | 272.17 g/mol |
| Exact Mass | 270.98 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-1-methylpyrazol-3-amine |
| SMILES | Cn1ccc(NCc2ccc(Br)s2)n1 |
| InChI | InChI=1S/C9H10BrN3S/c1-13-5-4-9(12-13)11-6-7-2-3-8(10)14-7/h2-5H,6H2,1H3,(H,11,12) |
| InChIKey | URASQMAHTBQWLU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.17 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |