C8H7BrN2OS — CID 130611411
N-[(5-bromothiophen-2-yl)methyl]-1,2-oxazol-3-amine (PubChem CID 130611411) has the molecular formula C8H7BrN2OS and a molecular weight of 259.13 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-1,2-oxazol-3-amine.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 130611411 |
| Molecular Formula | C8H7BrN2OS |
| Molecular Weight | 259.13 g/mol |
| Exact Mass | 257.95 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-1,2-oxazol-3-amine |
| SMILES | Brc1ccc(CNc2ccon2)s1 |
| InChI | InChI=1S/C8H7BrN2OS/c9-7-2-1-6(13-7)5-10-8-3-4-12-11-8/h1-4H,5H2,(H,10,11) |
| InChIKey | RCUCTXYKTBTDTC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.13 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |