C9H7BrIN3S — CID 66343007
N-[(5-bromothiophen-2-yl)methyl]-5-iodopyrimidin-4-amine (PubChem CID 66343007) has the molecular formula C9H7BrIN3S and a molecular weight of 396.05 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-5-iodopyrimidin-4-amine.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-5-iodopyrimidin-4-amine |
|---|---|
| PubChem CID | 66343007 |
| Molecular Formula | C9H7BrIN3S |
| Molecular Weight | 396.05 g/mol |
| Exact Mass | 394.86 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-5-iodopyrimidin-4-amine |
| SMILES | Brc1ccc(CNc2ncncc2I)s1 |
| InChI | InChI=1S/C9H7BrIN3S/c10-8-2-1-6(15-8)3-13-9-7(11)4-12-5-14-9/h1-2,4-5H,3H2,(H,12,13,14) |
| InChIKey | CZIFHYSQQXMTIN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.05 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|