C9H9Br2N5S — CID 80911404
5-bromo-N-[(5-bromothiophen-2-yl)methyl]-2-hydrazinylpyrimidin-4-amine (PubChem CID 80911404) has the molecular formula C9H9Br2N5S and a molecular weight of 379.08 g/mol. Its IUPAC name is 5-bromo-N-[(5-bromothiophen-2-yl)methyl]-2-hydrazinylpyrimidin-4-amine.
| Compound Name | 5-bromo-N-[(5-bromothiophen-2-yl)methyl]-2-hydrazinylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80911404 |
| Molecular Formula | C9H9Br2N5S |
| Molecular Weight | 379.08 g/mol |
| Exact Mass | 376.89 |
| IUPAC Name | 5-bromo-N-[(5-bromothiophen-2-yl)methyl]-2-hydrazinylpyrimidin-4-amine |
| SMILES | NNc1ncc(Br)c(NCc2ccc(Br)s2)n1 |
| InChI | InChI=1S/C9H9Br2N5S/c10-6-4-14-9(16-12)15-8(6)13-3-5-1-2-7(11)17-5/h1-2,4H,3,12H2,(H2,13,14,15,16) |
| InChIKey | AXESAYMHKUQWIH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.08 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|