C11H10BrN3S2 — CID 64595487
6-[(5-bromothiophen-2-yl)methylamino]pyridine-2-carbothioamide (PubChem CID 64595487) has the molecular formula C11H10BrN3S2 and a molecular weight of 328.26 g/mol. Its IUPAC name is 6-[(5-bromothiophen-2-yl)methylamino]pyridine-2-carbothioamide.
| Compound Name | 6-[(5-bromothiophen-2-yl)methylamino]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 64595487 |
| Molecular Formula | C11H10BrN3S2 |
| Molecular Weight | 328.26 g/mol |
| Exact Mass | 326.95 |
| IUPAC Name | 6-[(5-bromothiophen-2-yl)methylamino]pyridine-2-carbothioamide |
| SMILES | NC(=S)c1cccc(NCc2ccc(Br)s2)n1 |
| InChI | InChI=1S/C11H10BrN3S2/c12-9-5-4-7(17-9)6-14-10-3-1-2-8(15-10)11(13)16/h1-5H,6H2,(H2,13,16)(H,14,15) |
| InChIKey | WNKGEGQRSACTSN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.26 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|