C10H9BrN4S2 — CID 80511772
3-[(5-bromothiophen-2-yl)methylamino]pyridazine-4-carbothioamide (PubChem CID 80511772) has the molecular formula C10H9BrN4S2 and a molecular weight of 329.25 g/mol. Its IUPAC name is 3-[(5-bromothiophen-2-yl)methylamino]pyridazine-4-carbothioamide.
| Compound Name | 3-[(5-bromothiophen-2-yl)methylamino]pyridazine-4-carbothioamide |
|---|---|
| PubChem CID | 80511772 |
| Molecular Formula | C10H9BrN4S2 |
| Molecular Weight | 329.25 g/mol |
| Exact Mass | 327.95 |
| IUPAC Name | 3-[(5-bromothiophen-2-yl)methylamino]pyridazine-4-carbothioamide |
| SMILES | NC(=S)c1ccnnc1NCc1ccc(Br)s1 |
| InChI | InChI=1S/C10H9BrN4S2/c11-8-2-1-6(17-8)5-13-10-7(9(12)16)3-4-14-15-10/h1-4H,5H2,(H2,12,16)(H,13,15) |
| InChIKey | QBVDNVXOWXESGW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.25 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|