C12H11ClN4S — CID 80512063
3-[(4-chlorophenyl)methylamino]pyridazine-4-carbothioamide (PubChem CID 80512063) has the molecular formula C12H11ClN4S and a molecular weight of 278.77 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methylamino]pyridazine-4-carbothioamide.
| Compound Name | 3-[(4-chlorophenyl)methylamino]pyridazine-4-carbothioamide |
|---|---|
| PubChem CID | 80512063 |
| Molecular Formula | C12H11ClN4S |
| Molecular Weight | 278.77 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 3-[(4-chlorophenyl)methylamino]pyridazine-4-carbothioamide |
| SMILES | NC(=S)c1ccnnc1NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H11ClN4S/c13-9-3-1-8(2-4-9)7-15-12-10(11(14)18)5-6-16-17-12/h1-6H,7H2,(H2,14,18)(H,15,17) |
| InChIKey | ZBVNWIPTJWLASS-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.77 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|