C10H16N4S2 — CID 80511799
3-[(2-methyl-3-methylsulfanylpropyl)amino]pyridazine-4-carbothioamide (PubChem CID 80511799) has the molecular formula C10H16N4S2 and a molecular weight of 256.40 g/mol. Its IUPAC name is 3-[(2-methyl-3-methylsulfanylpropyl)amino]pyridazine-4-carbothioamide.
| Compound Name | 3-[(2-methyl-3-methylsulfanylpropyl)amino]pyridazine-4-carbothioamide |
|---|---|
| PubChem CID | 80511799 |
| Molecular Formula | C10H16N4S2 |
| Molecular Weight | 256.40 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 3-[(2-methyl-3-methylsulfanylpropyl)amino]pyridazine-4-carbothioamide |
| SMILES | CSCC(C)CNc1nnccc1C(N)=S |
| InChI | InChI=1S/C10H16N4S2/c1-7(6-16-2)5-12-10-8(9(11)15)3-4-13-14-10/h3-4,7H,5-6H2,1-2H3,(H2,11,15)(H,12,14) |
| InChIKey | CFWNSVYZFQXMNW-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.40 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|