C10H15N3O2S — CID 80516950
3-[(2-methyl-3-methylsulfanylpropyl)amino]pyridazine-4-carboxylic acid (PubChem CID 80516950) has the molecular formula C10H15N3O2S and a molecular weight of 241.32 g/mol. Its IUPAC name is 3-[(2-methyl-3-methylsulfanylpropyl)amino]pyridazine-4-carboxylic acid.
| Compound Name | 3-[(2-methyl-3-methylsulfanylpropyl)amino]pyridazine-4-carboxylic acid |
|---|---|
| PubChem CID | 80516950 |
| Molecular Formula | C10H15N3O2S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 3-[(2-methyl-3-methylsulfanylpropyl)amino]pyridazine-4-carboxylic acid |
| SMILES | CSCC(C)CNc1nnccc1C(=O)O |
| InChI | InChI=1S/C10H15N3O2S/c1-7(6-16-2)5-11-9-8(10(14)15)3-4-12-13-9/h3-4,7H,5-6H2,1-2H3,(H,11,13)(H,14,15) |
| InChIKey | YNXPWUBGTDNNJI-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |