C7H11N5S — CID 83016391
3-(2,2-dimethylhydrazinyl)pyridazine-4-carbothioamide (PubChem CID 83016391) has the molecular formula C7H11N5S and a molecular weight of 197.27 g/mol. Its IUPAC name is 3-(2,2-dimethylhydrazinyl)pyridazine-4-carbothioamide.
| Compound Name | 3-(2,2-dimethylhydrazinyl)pyridazine-4-carbothioamide |
|---|---|
| PubChem CID | 83016391 |
| Molecular Formula | C7H11N5S |
| Molecular Weight | 197.27 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 3-(2,2-dimethylhydrazinyl)pyridazine-4-carbothioamide |
| SMILES | CN(C)Nc1nnccc1C(N)=S |
| InChI | InChI=1S/C7H11N5S/c1-12(2)11-7-5(6(8)13)3-4-9-10-7/h3-4H,1-2H3,(H2,8,13)(H,10,11) |
| InChIKey | IIRPUTSOWBWFHP-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.27 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|