C13H14N4OS — CID 80510898
3-[(2-methoxyphenyl)methylamino]pyridazine-4-carbothioamide (PubChem CID 80510898) has the molecular formula C13H14N4OS and a molecular weight of 274.35 g/mol. Its IUPAC name is 3-[(2-methoxyphenyl)methylamino]pyridazine-4-carbothioamide.
| Compound Name | 3-[(2-methoxyphenyl)methylamino]pyridazine-4-carbothioamide |
|---|---|
| PubChem CID | 80510898 |
| Molecular Formula | C13H14N4OS |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 3-[(2-methoxyphenyl)methylamino]pyridazine-4-carbothioamide |
| SMILES | COc1ccccc1CNc1nnccc1C(N)=S |
| InChI | InChI=1S/C13H14N4OS/c1-18-11-5-3-2-4-9(11)8-15-13-10(12(14)19)6-7-16-17-13/h2-7H,8H2,1H3,(H2,14,19)(H,15,17) |
| InChIKey | UJZHSNKPEJBNPW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|