C14H17N3O — CID 115045042
3-(aminomethyl)-N-[(2-methoxyphenyl)methyl]pyridin-4-amine (PubChem CID 115045042) has the molecular formula C14H17N3O and a molecular weight of 243.31 g/mol. Its IUPAC name is 3-(aminomethyl)-N-[(2-methoxyphenyl)methyl]pyridin-4-amine.
| Compound Name | 3-(aminomethyl)-N-[(2-methoxyphenyl)methyl]pyridin-4-amine |
|---|---|
| PubChem CID | 115045042 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 3-(aminomethyl)-N-[(2-methoxyphenyl)methyl]pyridin-4-amine |
| SMILES | COc1ccccc1CNc1ccncc1CN |
| InChI | InChI=1S/C14H17N3O/c1-18-14-5-3-2-4-11(14)10-17-13-6-7-16-9-12(13)8-15/h2-7,9H,8,10,15H2,1H3,(H,16,17) |
| InChIKey | NLGNHYNCRYWKHN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |