C18H23N3O3 — CID 141022551
3-amino-N-[3-methoxy-4-[(2-methoxyphenyl)methylamino]phenyl]propanamide (PubChem CID 141022551) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 3-amino-N-[3-methoxy-4-[(2-methoxyphenyl)methylamino]phenyl]propanamide.
| Compound Name | 3-amino-N-[3-methoxy-4-[(2-methoxyphenyl)methylamino]phenyl]propanamide |
|---|---|
| PubChem CID | 141022551 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 3-amino-N-[3-methoxy-4-[(2-methoxyphenyl)methylamino]phenyl]propanamide |
| SMILES | COc1ccccc1CNc1ccc(NC(=O)CCN)cc1OC |
| InChI | InChI=1S/C18H23N3O3/c1-23-16-6-4-3-5-13(16)12-20-15-8-7-14(11-17(15)24-2)21-18(22)9-10-19/h3-8,11,20H,9-10,12,19H2,1-2H3,(H,21,22) |
| InChIKey | NMEJYZXXFPQLDW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |