C12H16N4S — CID 80511090
3-(dicyclopropylmethylamino)pyridazine-4-carbothioamide (PubChem CID 80511090) has the molecular formula C12H16N4S and a molecular weight of 248.35 g/mol. Its IUPAC name is 3-(dicyclopropylmethylamino)pyridazine-4-carbothioamide.
| Compound Name | 3-(dicyclopropylmethylamino)pyridazine-4-carbothioamide |
|---|---|
| PubChem CID | 80511090 |
| Molecular Formula | C12H16N4S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 3-(dicyclopropylmethylamino)pyridazine-4-carbothioamide |
| SMILES | NC(=S)c1ccnnc1NC(C1CC1)C1CC1 |
| InChI | InChI=1S/C12H16N4S/c13-11(17)9-5-6-14-16-12(9)15-10(7-1-2-7)8-3-4-8/h5-8,10H,1-4H2,(H2,13,17)(H,15,16) |
| InChIKey | YHZKAWPPNUCQQO-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|