C11H13N5S2 — CID 113387313
3-[1-(5-methyl-1,3-thiazol-2-yl)ethylamino]pyridazine-4-carbothioamide (PubChem CID 113387313) has the molecular formula C11H13N5S2 and a molecular weight of 279.39 g/mol. Its IUPAC name is 3-[1-(5-methyl-1,3-thiazol-2-yl)ethylamino]pyridazine-4-carbothioamide.
| Compound Name | 3-[1-(5-methyl-1,3-thiazol-2-yl)ethylamino]pyridazine-4-carbothioamide |
|---|---|
| PubChem CID | 113387313 |
| Molecular Formula | C11H13N5S2 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 3-[1-(5-methyl-1,3-thiazol-2-yl)ethylamino]pyridazine-4-carbothioamide |
| SMILES | Cc1cnc(C(C)Nc2nnccc2C(N)=S)s1 |
| InChI | InChI=1S/C11H13N5S2/c1-6-5-13-11(18-6)7(2)15-10-8(9(12)17)3-4-14-16-10/h3-5,7H,1-2H3,(H2,12,17)(H,15,16) |
| InChIKey | DDQPEHWIAXPXQU-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|