C12H13N3S2 — CID 64596062
6-[(5-methylthiophen-2-yl)methylamino]pyridine-2-carbothioamide (PubChem CID 64596062) has the molecular formula C12H13N3S2 and a molecular weight of 263.39 g/mol. Its IUPAC name is 6-[(5-methylthiophen-2-yl)methylamino]pyridine-2-carbothioamide.
| Compound Name | 6-[(5-methylthiophen-2-yl)methylamino]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 64596062 |
| Molecular Formula | C12H13N3S2 |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 6-[(5-methylthiophen-2-yl)methylamino]pyridine-2-carbothioamide |
| SMILES | Cc1ccc(CNc2cccc(C(N)=S)n2)s1 |
| InChI | InChI=1S/C12H13N3S2/c1-8-5-6-9(17-8)7-14-11-4-2-3-10(15-11)12(13)16/h2-6H,7H2,1H3,(H2,13,16)(H,14,15) |
| InChIKey | OIBCLTLJWAHMLD-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|