C7H9N5S — CID 60809159
1-methyl-N-(thiadiazol-4-ylmethyl)pyrazol-3-amine (PubChem CID 60809159) has the molecular formula C7H9N5S and a molecular weight of 195.25 g/mol. Its IUPAC name is 1-methyl-N-(thiadiazol-4-ylmethyl)pyrazol-3-amine.
| Compound Name | 1-methyl-N-(thiadiazol-4-ylmethyl)pyrazol-3-amine |
|---|---|
| PubChem CID | 60809159 |
| Molecular Formula | C7H9N5S |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 1-methyl-N-(thiadiazol-4-ylmethyl)pyrazol-3-amine |
| SMILES | Cn1ccc(NCc2csnn2)n1 |
| InChI | InChI=1S/C7H9N5S/c1-12-3-2-7(10-12)8-4-6-5-13-11-9-6/h2-3,5H,4H2,1H3,(H,8,10) |
| InChIKey | IJXKHMNRPUBKJS-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |