C10H12N4S2 — CID 115908368
4-(methylsulfanylmethyl)-N-(thiadiazol-4-ylmethyl)pyridin-2-amine (PubChem CID 115908368) has the molecular formula C10H12N4S2 and a molecular weight of 252.37 g/mol. Its IUPAC name is 4-(methylsulfanylmethyl)-N-(thiadiazol-4-ylmethyl)pyridin-2-amine.
| Compound Name | 4-(methylsulfanylmethyl)-N-(thiadiazol-4-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 115908368 |
| Molecular Formula | C10H12N4S2 |
| Molecular Weight | 252.37 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 4-(methylsulfanylmethyl)-N-(thiadiazol-4-ylmethyl)pyridin-2-amine |
| SMILES | CSCc1ccnc(NCc2csnn2)c1 |
| InChI | InChI=1S/C10H12N4S2/c1-15-6-8-2-3-11-10(4-8)12-5-9-7-16-14-13-9/h2-4,7H,5-6H2,1H3,(H,11,12) |
| InChIKey | CBFSANXAPKKXGV-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |