C9H10N4S2 — CID 115908362
5-methylsulfanyl-N-(thiadiazol-4-ylmethyl)pyridin-2-amine (PubChem CID 115908362) has the molecular formula C9H10N4S2 and a molecular weight of 238.34 g/mol. Its IUPAC name is 5-methylsulfanyl-N-(thiadiazol-4-ylmethyl)pyridin-2-amine.
| Compound Name | 5-methylsulfanyl-N-(thiadiazol-4-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 115908362 |
| Molecular Formula | C9H10N4S2 |
| Molecular Weight | 238.34 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 5-methylsulfanyl-N-(thiadiazol-4-ylmethyl)pyridin-2-amine |
| SMILES | CSc1ccc(NCc2csnn2)nc1 |
| InChI | InChI=1S/C9H10N4S2/c1-14-8-2-3-9(11-5-8)10-4-7-6-15-13-12-7/h2-3,5-6H,4H2,1H3,(H,10,11) |
| InChIKey | SULFMNDTLQEWLO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |