C9H11ClFN3S — CID 126964997
N-[(5-fluorothiophen-2-yl)methyl]-1-methylpyrazol-3-amine;hydrochloride (PubChem CID 126964997) has the molecular formula C9H11ClFN3S and a molecular weight of 247.73 g/mol. Its IUPAC name is N-[(5-fluorothiophen-2-yl)methyl]-1-methylpyrazol-3-amine;hydrochloride.
| Compound Name | N-[(5-fluorothiophen-2-yl)methyl]-1-methylpyrazol-3-amine;hydrochloride |
|---|---|
| PubChem CID | 126964997 |
| Molecular Formula | C9H11ClFN3S |
| Molecular Weight | 247.73 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | N-[(5-fluorothiophen-2-yl)methyl]-1-methylpyrazol-3-amine;hydrochloride |
| SMILES | Cl.Cn1ccc(NCc2ccc(F)s2)n1 |
| InChI | InChI=1S/C9H10FN3S.ClH/c1-13-5-4-9(12-13)11-6-7-2-3-8(10)14-7;/h2-5H,6H2,1H3,(H,11,12);1H |
| InChIKey | BLCDAMUSYPKTKS-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.73 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |