C8H11N5S — CID 130599823
1-methyl-N-[(4-methylthiadiazol-5-yl)methyl]pyrazol-3-amine (PubChem CID 130599823) has the molecular formula C8H11N5S and a molecular weight of 209.28 g/mol. Its IUPAC name is 1-methyl-N-[(4-methylthiadiazol-5-yl)methyl]pyrazol-3-amine.
| Compound Name | 1-methyl-N-[(4-methylthiadiazol-5-yl)methyl]pyrazol-3-amine |
|---|---|
| PubChem CID | 130599823 |
| Molecular Formula | C8H11N5S |
| Molecular Weight | 209.28 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 1-methyl-N-[(4-methylthiadiazol-5-yl)methyl]pyrazol-3-amine |
| SMILES | Cc1nnsc1CNc1ccn(C)n1 |
| InChI | InChI=1S/C8H11N5S/c1-6-7(14-12-10-6)5-9-8-3-4-13(2)11-8/h3-4H,5H2,1-2H3,(H,9,11) |
| InChIKey | ILBDLECLTWMTJX-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.28 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |