C10H10FN3O2S — CID 122165760
4-[(5-fluorothiophen-2-yl)methylamino]-1-methylpyrazole-3-carboxylic acid (PubChem CID 122165760) has the molecular formula C10H10FN3O2S and a molecular weight of 255.27 g/mol. Its IUPAC name is 4-[(5-fluorothiophen-2-yl)methylamino]-1-methylpyrazole-3-carboxylic acid.
| Compound Name | 4-[(5-fluorothiophen-2-yl)methylamino]-1-methylpyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 122165760 |
| Molecular Formula | C10H10FN3O2S |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | 4-[(5-fluorothiophen-2-yl)methylamino]-1-methylpyrazole-3-carboxylic acid |
| SMILES | Cn1cc(NCc2ccc(F)s2)c(C(=O)O)n1 |
| InChI | InChI=1S/C10H10FN3O2S/c1-14-5-7(9(13-14)10(15)16)12-4-6-2-3-8(11)17-6/h2-3,5,12H,4H2,1H3,(H,15,16) |
| InChIKey | LZLIBZWIAYXFPO-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |