About ethane;1,4,5-trimethylpyrazole-3-carbonitrile
ethane;1,4,5-trimethylpyrazole-3-carbonitrile (PubChem CID 177367250) has the molecular formula C9H15N3
and a molecular weight of 165.24 g/mol. Its IUPAC name is ethane;1,4,5-trimethylpyrazole-3-carbonitrile.
Molecular Properties
| Compound Name | ethane;1,4,5-trimethylpyrazole-3-carbonitrile |
| PubChem CID | 177367250 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | ethane;1,4,5-trimethylpyrazole-3-carbonitrile |
| SMILES | CC.Cc1c(C#N)nn(C)c1C |
| InChI | InChI=1S/C7H9N3.C2H6/c1-5-6(2)10(3)9-7(5)4-8;1-2/h1-3H3;1-2H3 |
| InChIKey | SBAYWRWLUVEBHG-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;1,4,5-trimethylpyrazole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1,4,5-trimethylpyrazole-3-carbonitrile?
The IUPAC name of ethane;1,4,5-trimethylpyrazole-3-carbonitrile (CID 177367250) is ethane;1,4,5-trimethylpyrazole-3-carbonitrile.
What is the SMILES notation for ethane;1,4,5-trimethylpyrazole-3-carbonitrile?
The canonical SMILES for ethane;1,4,5-trimethylpyrazole-3-carbonitrile is CC.Cc1c(C#N)nn(C)c1C.
What is the InChIKey of ethane;1,4,5-trimethylpyrazole-3-carbonitrile?
The InChIKey is SBAYWRWLUVEBHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3.C2H6/c1-5-6(2)10(3)9-7(5)4-8;1-2/h1-3H3;1-2H3.
What are the key properties of ethane;1,4,5-trimethylpyrazole-3-carbonitrile?
ethane;1,4,5-trimethylpyrazole-3-carbonitrile has a molecular weight of 165.24 g/mol, XLogP of 1.93, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1,4,5-trimethylpyrazole-3-carbonitrile is sourced from PubChem (CID 177367250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).