About 2-(4-bromo-1,5-dimethylpyrazol-3-yl)acetonitrile
2-(4-bromo-1,5-dimethylpyrazol-3-yl)acetonitrile (PubChem CID 154776027) has the molecular formula C7H8BrN3
and a molecular weight of 214.07 g/mol. Its IUPAC name is 2-(4-bromo-1,5-dimethylpyrazol-3-yl)acetonitrile.
Analyze 2-(4-bromo-1,5-dimethylpyrazol-3-yl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromo-1,5-dimethylpyrazol-3-yl)acetonitrile?
The IUPAC name of 2-(4-bromo-1,5-dimethylpyrazol-3-yl)acetonitrile (CID 154776027) is 2-(4-bromo-1,5-dimethylpyrazol-3-yl)acetonitrile.
What is the SMILES notation for 2-(4-bromo-1,5-dimethylpyrazol-3-yl)acetonitrile?
The canonical SMILES for 2-(4-bromo-1,5-dimethylpyrazol-3-yl)acetonitrile is Cc1c(Br)c(CC#N)nn1C.
What is the InChIKey of 2-(4-bromo-1,5-dimethylpyrazol-3-yl)acetonitrile?
The InChIKey is XNBPPBNACMGAPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8BrN3/c1-5-7(8)6(3-4-9)10-11(5)2/h3H2,1-2H3.
What are the key properties of 2-(4-bromo-1,5-dimethylpyrazol-3-yl)acetonitrile?
2-(4-bromo-1,5-dimethylpyrazol-3-yl)acetonitrile has a molecular weight of 214.07 g/mol, XLogP of 1.56, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromo-1,5-dimethylpyrazol-3-yl)acetonitrile is sourced from PubChem (CID 154776027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).