C5H5Br3N2 — CID 12601669
4,5-dibromo-3-(bromomethyl)-1-methylpyrazole (PubChem CID 12601669) has the molecular formula C5H5Br3N2 and a molecular weight of 332.82 g/mol. Its IUPAC name is 4,5-dibromo-3-(bromomethyl)-1-methylpyrazole.
| Compound Name | 4,5-dibromo-3-(bromomethyl)-1-methylpyrazole |
|---|---|
| PubChem CID | 12601669 |
| Molecular Formula | C5H5Br3N2 |
| Molecular Weight | 332.82 g/mol |
| Exact Mass | 329.80 |
| IUPAC Name | 4,5-dibromo-3-(bromomethyl)-1-methylpyrazole |
| SMILES | Cn1nc(CBr)c(Br)c1Br |
| InChI | InChI=1S/C5H5Br3N2/c1-10-5(8)4(7)3(2-6)9-10/h2H2,1H3 |
| InChIKey | ZDJYRAZNLMCRGT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.82 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|