C27H31N5O2 — CID 102164370
1,3-dimethyl-7-(2-phenylethynyl)-6-(1-piperidin-1-ylcyclohexyl)pteridine-2,4-dione (PubChem CID 102164370) has the molecular formula C27H31N5O2 and a molecular weight of 457.58 g/mol. Its IUPAC name is 1,3-dimethyl-7-(2-phenylethynyl)-6-(1-piperidin-1-ylcyclohexyl)pteridine-2,4-dione.
| Compound Name | 1,3-dimethyl-7-(2-phenylethynyl)-6-(1-piperidin-1-ylcyclohexyl)pteridine-2,4-dione |
|---|---|
| PubChem CID | 102164370 |
| Molecular Formula | C27H31N5O2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | 1,3-dimethyl-7-(2-phenylethynyl)-6-(1-piperidin-1-ylcyclohexyl)pteridine-2,4-dione |
| SMILES | Cn1c(=O)c2nc(C3(N4CCCCC4)CCCCC3)c(C#Cc3ccccc3)nc2n(C)c1=O |
| InChI | InChI=1S/C27H31N5O2/c1-30-24-22(25(33)31(2)26(30)34)29-23(21(28-24)15-14-20-12-6-3-7-13-20)27(16-8-4-9-17-27)32-18-10-5-11-19-32/h3,6-7,12-13H,4-5,8-11,16-19H2,1-2H3 |
| InChIKey | FMQSXVVHBZZUKW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 73.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|