C16H17F3N4O5S — CID 101030673
[1,3-dimethyl-7-(5-methylhex-1-ynyl)-2,4-dioxopteridin-6-yl] trifluoromethanesulfonate (PubChem CID 101030673) has the molecular formula C16H17F3N4O5S and a molecular weight of 434.40 g/mol. Its IUPAC name is [1,3-dimethyl-7-(5-methylhex-1-ynyl)-2,4-dioxopteridin-6-yl] trifluoromethanesulfonate.
| Compound Name | [1,3-dimethyl-7-(5-methylhex-1-ynyl)-2,4-dioxopteridin-6-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 101030673 |
| Molecular Formula | C16H17F3N4O5S |
| Molecular Weight | 434.40 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | [1,3-dimethyl-7-(5-methylhex-1-ynyl)-2,4-dioxopteridin-6-yl] trifluoromethanesulfonate |
| SMILES | CC(C)CCC#Cc1nc2c(nc1OS(=O)(=O)C(F)(F)F)c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C16H17F3N4O5S/c1-9(2)7-5-6-8-10-13(28-29(26,27)16(17,18)19)21-11-12(20-10)22(3)15(25)23(4)14(11)24/h9H,5,7H2,1-4H3 |
| InChIKey | OXBQVTRDMGDSGG-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 113.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.40 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|