C24H29N4O8P — CID 110171714
(1,3-dimethyl-2,4-dioxo-6-phenylpteridin-7-yl) bis(oxolan-2-ylmethyl) phosphate (PubChem CID 110171714) has the molecular formula C24H29N4O8P and a molecular weight of 532.49 g/mol. Its IUPAC name is (1,3-dimethyl-2,4-dioxo-6-phenylpteridin-7-yl) bis(oxolan-2-ylmethyl) phosphate.
| Compound Name | (1,3-dimethyl-2,4-dioxo-6-phenylpteridin-7-yl) bis(oxolan-2-ylmethyl) phosphate |
|---|---|
| PubChem CID | 110171714 |
| Molecular Formula | C24H29N4O8P |
| Molecular Weight | 532.49 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | (1,3-dimethyl-2,4-dioxo-6-phenylpteridin-7-yl) bis(oxolan-2-ylmethyl) phosphate |
| SMILES | Cn1c(=O)c2nc(-c3ccccc3)c(OP(=O)(OCC3CCCO3)OCC3CCCO3)nc2n(C)c1=O |
| InChI | InChI=1S/C24H29N4O8P/c1-27-21-20(23(29)28(2)24(27)30)25-19(16-8-4-3-5-9-16)22(26-21)36-37(31,34-14-17-10-6-12-32-17)35-15-18-11-7-13-33-18/h3-5,8-9,17-18H,6-7,10-15H2,1-2H3 |
| InChIKey | OJDGWMIPOWPJPU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 133.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.49 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|