C18H18N6O5 — CID 93065431
3-(4-methyl-3,5-dioxo-2-phenyl-1,2,4-triazin-6-yl)-N-[[(2R)-oxolan-2-yl]methyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 93065431) has the molecular formula C18H18N6O5 and a molecular weight of 398.38 g/mol. Its IUPAC name is 3-(4-methyl-3,5-dioxo-2-phenyl-1,2,4-triazin-6-yl)-N-[[(2R)-oxolan-2-yl]methyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-(4-methyl-3,5-dioxo-2-phenyl-1,2,4-triazin-6-yl)-N-[[(2R)-oxolan-2-yl]methyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 93065431 |
| Molecular Formula | C18H18N6O5 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 3-(4-methyl-3,5-dioxo-2-phenyl-1,2,4-triazin-6-yl)-N-[[(2R)-oxolan-2-yl]methyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | Cn1c(=O)c(-c2noc(C(=O)NC[C@H]3CCCO3)n2)nn(-c2ccccc2)c1=O |
| InChI | InChI=1S/C18H18N6O5/c1-23-17(26)13(21-24(18(23)27)11-6-3-2-4-7-11)14-20-16(29-22-14)15(25)19-10-12-8-5-9-28-12/h2-4,6-7,12H,5,8-10H2,1H3,(H,19,25)/t12-/m1/s1 |
| InChIKey | VUWPHPDESYVBLR-GFCCVEGCSA-N |
| XLogP | -0.11 |
| TPSA | 134.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |